C16H19N3 — CID 151947082
9-butyl-N-methylpyrido[3,4-b]indol-1-amine (PubChem CID 151947082) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 9-butyl-N-methylpyrido[3,4-b]indol-1-amine.
| Compound Name | 9-butyl-N-methylpyrido[3,4-b]indol-1-amine |
|---|---|
| PubChem CID | 151947082 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 9-butyl-N-methylpyrido[3,4-b]indol-1-amine |
| SMILES | CCCCn1c2ccccc2c2ccnc(NC)c21 |
| InChI | InChI=1S/C16H19N3/c1-3-4-11-19-14-8-6-5-7-12(14)13-9-10-18-16(17-2)15(13)19/h5-10H,3-4,11H2,1-2H3,(H,17,18) |
| InChIKey | TVWJROCSRJXYIK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |