C17H22N4 — CID 141187470
1-N'-(9-butylpyrido[3,4-b]indol-1-yl)ethane-1,1-diamine (PubChem CID 141187470) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-N'-(9-butylpyrido[3,4-b]indol-1-yl)ethane-1,1-diamine.
| Compound Name | 1-N'-(9-butylpyrido[3,4-b]indol-1-yl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 141187470 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-N'-(9-butylpyrido[3,4-b]indol-1-yl)ethane-1,1-diamine |
| SMILES | CCCCn1c2ccccc2c2ccnc(NC(C)N)c21 |
| InChI | InChI=1S/C17H22N4/c1-3-4-11-21-15-8-6-5-7-13(15)14-9-10-19-17(16(14)21)20-12(2)18/h5-10,12H,3-4,11,18H2,1-2H3,(H,19,20) |
| InChIKey | VNLAQHNFKSKKPL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|