C18H16ClN7O2 — CID 140500884
5-amino-N-[1-(2-chloro-3-pyridinyl)propyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidine-7-carboxamide (PubChem CID 140500884) has the molecular formula C18H16ClN7O2 and a molecular weight of 397.83 g/mol. Its IUPAC name is 5-amino-N-[1-(2-chloro-3-pyridinyl)propyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidine-7-carboxamide.
| Compound Name | 5-amino-N-[1-(2-chloro-3-pyridinyl)propyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 140500884 |
| Molecular Formula | C18H16ClN7O2 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 5-amino-N-[1-(2-chloro-3-pyridinyl)propyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidine-7-carboxamide |
| SMILES | CCC(NC(=O)c1cc2nc(-c3ccco3)nn2c(N)n1)c1cccnc1Cl |
| InChI | InChI=1S/C18H16ClN7O2/c1-2-11(10-5-3-7-21-15(10)19)22-17(27)12-9-14-24-16(13-6-4-8-28-13)25-26(14)18(20)23-12/h3-9,11H,2H2,1H3,(H2,20,23)(H,22,27) |
| InChIKey | XPOSGSIKDSJKLJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|