C10H19I2N3S — CID 140503854
6-N-propyl-5,6,7,7a-tetrahydro-1,3-benzothiazole-2,6-diamine;dihydroiodide (PubChem CID 140503854) has the molecular formula C10H19I2N3S and a molecular weight of 467.16 g/mol. Its IUPAC name is 6-N-propyl-5,6,7,7a-tetrahydro-1,3-benzothiazole-2,6-diamine;dihydroiodide.
| Compound Name | 6-N-propyl-5,6,7,7a-tetrahydro-1,3-benzothiazole-2,6-diamine;dihydroiodide |
|---|---|
| PubChem CID | 140503854 |
| Molecular Formula | C10H19I2N3S |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | 6-N-propyl-5,6,7,7a-tetrahydro-1,3-benzothiazole-2,6-diamine;dihydroiodide |
| SMILES | CCCNC1CC=C2N=C(N)SC2C1.I.I |
| InChI | InChI=1S/C10H17N3S.2HI/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;;/h4,7,9,12H,2-3,5-6H2,1H3,(H2,11,13);2*1H |
| InChIKey | LHTXRQPIGHYHQE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|