C15H13BrS — CID 140504811
2-(7-bromo-2-methyl-3H-inden-5-yl)-5-methylthiophene (PubChem CID 140504811) has the molecular formula C15H13BrS and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-(7-bromo-2-methyl-3H-inden-5-yl)-5-methylthiophene.
| Compound Name | 2-(7-bromo-2-methyl-3H-inden-5-yl)-5-methylthiophene |
|---|---|
| PubChem CID | 140504811 |
| Molecular Formula | C15H13BrS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-(7-bromo-2-methyl-3H-inden-5-yl)-5-methylthiophene |
| SMILES | CC1=Cc2c(Br)cc(-c3ccc(C)s3)cc2C1 |
| InChI | InChI=1S/C15H13BrS/c1-9-5-11-7-12(8-14(16)13(11)6-9)15-4-3-10(2)17-15/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | UXANYNHURHDRMJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |