C15H8F3IN4O — CID 140506406
2-[(3-cyano-4-fluorophenyl)hydrazinylidene]-2-(2,3-difluoro-4-iodophenyl)acetamide (PubChem CID 140506406) has the molecular formula C15H8F3IN4O and a molecular weight of 444.15 g/mol. Its IUPAC name is 2-[(3-cyano-4-fluorophenyl)hydrazinylidene]-2-(2,3-difluoro-4-iodophenyl)acetamide.
| Compound Name | 2-[(3-cyano-4-fluorophenyl)hydrazinylidene]-2-(2,3-difluoro-4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 140506406 |
| Molecular Formula | C15H8F3IN4O |
| Molecular Weight | 444.15 g/mol |
| Exact Mass | 443.97 |
| IUPAC Name | 2-[(3-cyano-4-fluorophenyl)hydrazinylidene]-2-(2,3-difluoro-4-iodophenyl)acetamide |
| SMILES | N#Cc1cc(NN=C(C(N)=O)c2ccc(I)c(F)c2F)ccc1F |
| InChI | InChI=1S/C15H8F3IN4O/c16-10-3-1-8(5-7(10)6-20)22-23-14(15(21)24)9-2-4-11(19)13(18)12(9)17/h1-5,22H,(H2,21,24) |
| InChIKey | DGGBSPSGDUWQLL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|