C15H6F6IN3 — CID 24774060
5-[(2Z)-2-[1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethylidene]hydrazinyl]-2-fluorobenzonitrile (PubChem CID 24774060) has the molecular formula C15H6F6IN3 and a molecular weight of 469.13 g/mol. Its IUPAC name is 5-[(2Z)-2-[1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethylidene]hydrazinyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2Z)-2-[1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethylidene]hydrazinyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 24774060 |
| Molecular Formula | C15H6F6IN3 |
| Molecular Weight | 469.13 g/mol |
| Exact Mass | 468.95 |
| IUPAC Name | 5-[(2Z)-2-[1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethylidene]hydrazinyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(N/N=C(/c2ccc(I)c(F)c2F)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C15H6F6IN3/c16-10-3-1-8(5-7(10)6-23)24-25-14(15(19,20)21)9-2-4-11(22)13(18)12(9)17/h1-5,24H/b25-14- |
| InChIKey | KCWZPIFYQABCSC-QFEZKATASA-N |
| XLogP | 4.96 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.13 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|