C20H12N2O5 — CID 140506802
[4-(4,8-dioxo-5H-pyrano[3,2-b]pyridin-2-yl)phenyl] pyridine-3-carboxylate (PubChem CID 140506802) has the molecular formula C20H12N2O5 and a molecular weight of 360.33 g/mol. Its IUPAC name is [4-(4,8-dioxo-5H-pyrano[3,2-b]pyridin-2-yl)phenyl] pyridine-3-carboxylate.
| Compound Name | [4-(4,8-dioxo-5H-pyrano[3,2-b]pyridin-2-yl)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140506802 |
| Molecular Formula | C20H12N2O5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | [4-(4,8-dioxo-5H-pyrano[3,2-b]pyridin-2-yl)phenyl] pyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(-c2cc(=O)c3[nH]ccc(=O)c3o2)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H12N2O5/c23-15-7-9-22-18-16(24)10-17(27-19(15)18)12-3-5-14(6-4-12)26-20(25)13-2-1-8-21-11-13/h1-11H,(H,22,23) |
| InChIKey | COAAYFWWAHYSQA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|