C19H11N3O5 — CID 140506791
[4-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl] pyridine-3-carboxylate (PubChem CID 140506791) has the molecular formula C19H11N3O5 and a molecular weight of 361.31 g/mol. Its IUPAC name is [4-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl] pyridine-3-carboxylate.
| Compound Name | [4-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140506791 |
| Molecular Formula | C19H11N3O5 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [4-(3,8-dioxo-4H-pyrano[2,3-b]pyrazin-6-yl)phenyl] pyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(-c2cc(=O)c3ncc(=O)[nH]c3o2)cc1)c1cccnc1 |
| InChI | InChI=1S/C19H11N3O5/c23-14-8-15(27-18-17(14)21-10-16(24)22-18)11-3-5-13(6-4-11)26-19(25)12-2-1-7-20-9-12/h1-10H,(H,22,24) |
| InChIKey | AJZOTJBVXPKLGC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|