C17H16O4 — CID 140507871
2-(3,5-dimethoxybenzoyl)-3-methylbenzaldehyde (PubChem CID 140507871) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-(3,5-dimethoxybenzoyl)-3-methylbenzaldehyde.
| Compound Name | 2-(3,5-dimethoxybenzoyl)-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 140507871 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(3,5-dimethoxybenzoyl)-3-methylbenzaldehyde |
| SMILES | COc1cc(OC)cc(C(=O)c2c(C)cccc2C=O)c1 |
| InChI | InChI=1S/C17H16O4/c1-11-5-4-6-12(10-18)16(11)17(19)13-7-14(20-2)9-15(8-13)21-3/h4-10H,1-3H3 |
| InChIKey | LGSGRUPZUYZJJX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|