C32H25F5O7S2 — CID 140508850
[1,1,1,3,3-pentafluoro-3-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenyl-λ4-sulfanyl]oxysulfonylpropan-2-yl] benzoate (PubChem CID 140508850) has the molecular formula C32H25F5O7S2 and a molecular weight of 680.67 g/mol. Its IUPAC name is [1,1,1,3,3-pentafluoro-3-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenyl-λ4-sulfanyl]oxysulfonylpropan-2-yl] benzoate.
| Compound Name | [1,1,1,3,3-pentafluoro-3-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenyl-λ4-sulfanyl]oxysulfonylpropan-2-yl] benzoate |
|---|---|
| PubChem CID | 140508850 |
| Molecular Formula | C32H25F5O7S2 |
| Molecular Weight | 680.67 g/mol |
| Exact Mass | 680.10 |
| IUPAC Name | [1,1,1,3,3-pentafluoro-3-[[4-(2-methylprop-2-enoyloxy)phenyl]-diphenyl-λ4-sulfanyl]oxysulfonylpropan-2-yl] benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(S(OS(=O)(=O)C(F)(F)C(OC(=O)c2ccccc2)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H25F5O7S2/c1-22(2)28(38)42-24-18-20-27(21-19-24)45(25-14-8-4-9-15-25,26-16-10-5-11-17-26)44-46(40,41)32(36,37)30(31(33,34)35)43-29(39)23-12-6-3-7-13-23/h3-21,30H,1H2,2H3 |
| InChIKey | ZIZZSNKRYMQWRE-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.67 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|