C25H27F3O5S — CID 163359692
[(E)-1-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]sulfonylpent-3-enyl] benzoate (PubChem CID 163359692) has the molecular formula C25H27F3O5S and a molecular weight of 496.55 g/mol. Its IUPAC name is [(E)-1-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]sulfonylpent-3-enyl] benzoate.
| Compound Name | [(E)-1-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]sulfonylpent-3-enyl] benzoate |
|---|---|
| PubChem CID | 163359692 |
| Molecular Formula | C25H27F3O5S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [(E)-1-cyclohexyl-5-[4-(trifluoromethoxy)phenyl]sulfonylpent-3-enyl] benzoate |
| SMILES | O=C(OC(C/C=C/CS(=O)(=O)c1ccc(OC(F)(F)F)cc1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H27F3O5S/c26-25(27,28)33-21-14-16-22(17-15-21)34(30,31)18-8-7-13-23(19-9-3-1-4-10-19)32-24(29)20-11-5-2-6-12-20/h2,5-8,11-12,14-17,19,23H,1,3-4,9-10,13,18H2/b8-7+ |
| InChIKey | UHCHJYBLGVZZSI-BQYQJAHWSA-N |
| XLogP | 6.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|