C21H26N4O — CID 140510089
1-(4-methylphenyl)-1-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea (PubChem CID 140510089) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-(4-methylphenyl)-1-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea.
| Compound Name | 1-(4-methylphenyl)-1-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea |
|---|---|
| PubChem CID | 140510089 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1-(4-methylphenyl)-1-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea |
| SMILES | Cc1ccc(N(C(N)=O)C2C3CCN(CC3)C2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C21H26N4O/c1-15-4-6-18(7-5-15)25(21(22)26)20-17-8-11-24(12-9-17)19(20)13-16-3-2-10-23-14-16/h2-7,10,14,17,19-20H,8-9,11-13H2,1H3,(H2,22,26) |
| InChIKey | AMHMYYGMGOMEHG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |