C17H17ClN2O2S — CID 140512708
4-[7-chloro-1-(oxan-4-ylmethyl)indol-3-yl]-3H-1,3-thiazol-2-one (PubChem CID 140512708) has the molecular formula C17H17ClN2O2S and a molecular weight of 348.86 g/mol. Its IUPAC name is 4-[7-chloro-1-(oxan-4-ylmethyl)indol-3-yl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[7-chloro-1-(oxan-4-ylmethyl)indol-3-yl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 140512708 |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 4-[7-chloro-1-(oxan-4-ylmethyl)indol-3-yl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(-c2cn(CC3CCOCC3)c3c(Cl)cccc23)cs1 |
| InChI | InChI=1S/C17H17ClN2O2S/c18-14-3-1-2-12-13(15-10-23-17(21)19-15)9-20(16(12)14)8-11-4-6-22-7-5-11/h1-3,9-11H,4-8H2,(H,19,21) |
| InChIKey | XIXJPPPAIQVFGX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |