About azirino[2,3-g]indole
azirino[2,3-g]indole (PubChem CID 140512973) has the molecular formula C8H4N2
and a molecular weight of 128.13 g/mol. Its IUPAC name is azirino[2,3-g]indole.
Molecular Properties
| Compound Name | azirino[2,3-g]indole |
| PubChem CID | 140512973 |
| Molecular Formula | C8H4N2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | azirino[2,3-g]indole |
| SMILES | c1cc2ccc3nc3c2n1 |
| InChI | InChI=1S/C8H4N2/c1-2-6-8(10-6)7-5(1)3-4-9-7/h1-4H |
| InChIKey | HWFPJTUFVPDDPN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azirino[2,3-g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azirino[2,3-g]indole?
The IUPAC name of azirino[2,3-g]indole (CID 140512973) is azirino[2,3-g]indole.
What is the SMILES notation for azirino[2,3-g]indole?
The canonical SMILES for azirino[2,3-g]indole is c1cc2ccc3nc3c2n1.
What is the InChIKey of azirino[2,3-g]indole?
The InChIKey is HWFPJTUFVPDDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2/c1-2-6-8(10-6)7-5(1)3-4-9-7/h1-4H.
What are the key properties of azirino[2,3-g]indole?
azirino[2,3-g]indole has a molecular weight of 128.13 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azirino[2,3-g]indole is sourced from PubChem (CID 140512973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).