C8H4N2 — CID 140512973
azirino[2,3-g]indole (PubChem CID 140512973) has the molecular formula C8H4N2 and a molecular weight of 128.13 g/mol. Its IUPAC name is azirino[2,3-g]indole.
| Compound Name | azirino[2,3-g]indole |
|---|---|
| PubChem CID | 140512973 |
| Molecular Formula | C8H4N2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | azirino[2,3-g]indole |
| SMILES | c1cc2ccc3nc3c2n1 |
| InChI | InChI=1S/C8H4N2/c1-2-6-8(10-6)7-5(1)3-4-9-7/h1-4H |
| InChIKey | HWFPJTUFVPDDPN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |