C20H13N3O4S — CID 140515699
2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 140515699) has the molecular formula C20H13N3O4S and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 140515699 |
| Molecular Formula | C20H13N3O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCc1ccnc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H13N3O4S/c24-18-13-4-1-2-5-14(13)19(25)23(18)16-10-12(7-9-21-16)11-28-17-15(20(26)27)6-3-8-22-17/h1-10H,11H2,(H,26,27) |
| InChIKey | WLGSDSAYBBQDND-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|