About 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid
2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 140515699) has the molecular formula C20H13N3O4S
and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid |
| PubChem CID | 140515699 |
| Molecular Formula | C20H13N3O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCc1ccnc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H13N3O4S/c24-18-13-4-1-2-5-14(13)19(25)23(18)16-10-12(7-9-21-16)11-28-17-15(20(26)27)6-3-8-22-17/h1-10H,11H2,(H,26,27) |
| InChIKey | WLGSDSAYBBQDND-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid?
The IUPAC name of 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid (CID 140515699) is 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid?
The canonical SMILES for 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid is O=C(O)c1cccnc1SCc1ccnc(N2C(=O)c3ccccc3C2=O)c1.
What is the InChIKey of 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid?
The InChIKey is WLGSDSAYBBQDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13N3O4S/c24-18-13-4-1-2-5-14(13)19(25)23(18)16-10-12(7-9-21-16)11-28-17-15(20(26)27)6-3-8-22-17/h1-10H,11H2,(H,26,27).
What are the key properties of 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid?
2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid has a molecular weight of 391.41 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1,3-dioxoisoindol-2-yl)-4-pyridinyl]methylsulfanyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 140515699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).