C50H47N — CID 140516688
N-(4-tert-butylcyclohexa-1,5-dien-1-yl)-N-(4-tert-butylphenyl)-10-(6,7-dihydropyren-1-yl)anthracen-9-amine (PubChem CID 140516688) has the molecular formula C50H47N and a molecular weight of 661.93 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexa-1,5-dien-1-yl)-N-(4-tert-butylphenyl)-10-(6,7-dihydropyren-1-yl)anthracen-9-amine.
| Compound Name | N-(4-tert-butylcyclohexa-1,5-dien-1-yl)-N-(4-tert-butylphenyl)-10-(6,7-dihydropyren-1-yl)anthracen-9-amine |
|---|---|
| PubChem CID | 140516688 |
| Molecular Formula | C50H47N |
| Molecular Weight | 661.93 g/mol |
| Exact Mass | 661.37 |
| IUPAC Name | N-(4-tert-butylcyclohexa-1,5-dien-1-yl)-N-(4-tert-butylphenyl)-10-(6,7-dihydropyren-1-yl)anthracen-9-amine |
| SMILES | CC(C)(C)c1ccc(N(C2=CCC(C(C)(C)C)C=C2)c2c3ccccc3c(-c3ccc4ccc5c6c(ccc3c46)=CCC5)c3ccccc23)cc1 |
| InChI | InChI=1S/C50H47N/c1-49(2,3)35-22-26-37(27-23-35)51(38-28-24-36(25-29-38)50(4,5)6)48-43-16-9-7-14-39(43)47(40-15-8-10-17-44(40)48)42-31-21-34-19-18-32-12-11-13-33-20-30-41(42)46(34)45(32)33/h7-10,13-24,26-31,36H,11-12,25H2,1-6H3 |
| InChIKey | SAAOCHRPCCKRSO-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.93 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|