C21H18F2O6 — CID 140518411
[(2R,3R)-4,4-difluoro-5-oxo-3-(2-phenylacetyl)oxyoxolan-2-yl]methyl 2-phenylacetate (PubChem CID 140518411) has the molecular formula C21H18F2O6 and a molecular weight of 404.37 g/mol. Its IUPAC name is [(2R,3R)-4,4-difluoro-5-oxo-3-(2-phenylacetyl)oxyoxolan-2-yl]methyl 2-phenylacetate.
| Compound Name | [(2R,3R)-4,4-difluoro-5-oxo-3-(2-phenylacetyl)oxyoxolan-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 140518411 |
| Molecular Formula | C21H18F2O6 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(2R,3R)-4,4-difluoro-5-oxo-3-(2-phenylacetyl)oxyoxolan-2-yl]methyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OC[C@H]1OC(=O)C(F)(F)[C@@H]1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H18F2O6/c22-21(23)19(29-18(25)12-15-9-5-2-6-10-15)16(28-20(21)26)13-27-17(24)11-14-7-3-1-4-8-14/h1-10,16,19H,11-13H2/t16-,19-/m1/s1 |
| InChIKey | BRKLAXRCZVQCMV-VQIMIIECSA-N |
| XLogP | 2.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|