C23H33N3O3S — CID 140518634
(2S)-2-[[2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-3-cyclohexyl-N-(2-methoxyethyl)propanamide (PubChem CID 140518634) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is (2S)-2-[[2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-3-cyclohexyl-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-[[2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-3-cyclohexyl-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 140518634 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (2S)-2-[[2-amino-3-(1-benzothiophen-3-yl)propanoyl]amino]-3-cyclohexyl-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@H](CC1CCCCC1)NC(=O)C(N)Cc1csc2ccccc12 |
| InChI | InChI=1S/C23H33N3O3S/c1-29-12-11-25-23(28)20(13-16-7-3-2-4-8-16)26-22(27)19(24)14-17-15-30-21-10-6-5-9-18(17)21/h5-6,9-10,15-16,19-20H,2-4,7-8,11-14,24H2,1H3,(H,25,28)(H,26,27)/t19?,20-/m0/s1 |
| InChIKey | BGUOHKMEHKHQKV-ANYOKISRSA-N |
| XLogP | 2.99 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|