C24H32ClN3O3S — CID 70982224
5-[(3-chloroanilino)methyl]-N-[3-cyclohexyl-1-(2-methoxyethylamino)-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 70982224) has the molecular formula C24H32ClN3O3S and a molecular weight of 478.06 g/mol. Its IUPAC name is 5-[(3-chloroanilino)methyl]-N-[3-cyclohexyl-1-(2-methoxyethylamino)-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-[(3-chloroanilino)methyl]-N-[3-cyclohexyl-1-(2-methoxyethylamino)-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70982224 |
| Molecular Formula | C24H32ClN3O3S |
| Molecular Weight | 478.06 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 5-[(3-chloroanilino)methyl]-N-[3-cyclohexyl-1-(2-methoxyethylamino)-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | COCCNC(=O)C(CC1CCCCC1)NC(=O)c1ccc(CNc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C24H32ClN3O3S/c1-31-13-12-26-23(29)21(14-17-6-3-2-4-7-17)28-24(30)22-11-10-20(32-22)16-27-19-9-5-8-18(25)15-19/h5,8-11,15,17,21,27H,2-4,6-7,12-14,16H2,1H3,(H,26,29)(H,28,30) |
| InChIKey | DHSUZNKVALZDLX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.06 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|