C16H22O7S — CID 140519483
2,3-bis(butoxycarbonyl)benzenesulfonic acid (PubChem CID 140519483) has the molecular formula C16H22O7S and a molecular weight of 358.41 g/mol. Its IUPAC name is 2,3-bis(butoxycarbonyl)benzenesulfonic acid.
| Compound Name | 2,3-bis(butoxycarbonyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 140519483 |
| Molecular Formula | C16H22O7S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2,3-bis(butoxycarbonyl)benzenesulfonic acid |
| SMILES | CCCCOC(=O)c1cccc(S(=O)(=O)O)c1C(=O)OCCCC |
| InChI | InChI=1S/C16H22O7S/c1-3-5-10-22-15(17)12-8-7-9-13(24(19,20)21)14(12)16(18)23-11-6-4-2/h7-9H,3-6,10-11H2,1-2H3,(H,19,20,21) |
| InChIKey | PWZVBCVXFTXTRY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|