C22H24F3NO7S — CID 140521699
[2-(benzenesulfonyloxy)-1-(3-nitro-1-adamantyl)ethyl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 140521699) has the molecular formula C22H24F3NO7S and a molecular weight of 503.50 g/mol. Its IUPAC name is [2-(benzenesulfonyloxy)-1-(3-nitro-1-adamantyl)ethyl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-(benzenesulfonyloxy)-1-(3-nitro-1-adamantyl)ethyl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 140521699 |
| Molecular Formula | C22H24F3NO7S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | [2-(benzenesulfonyloxy)-1-(3-nitro-1-adamantyl)ethyl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(COS(=O)(=O)c1ccccc1)C12CC3CC(C1)CC([N+](=O)[O-])(C3)C2)C(F)(F)F |
| InChI | InChI=1S/C22H24F3NO7S/c1-14(22(23,24)25)19(27)33-18(12-32-34(30,31)17-5-3-2-4-6-17)20-8-15-7-16(9-20)11-21(10-15,13-20)26(28)29/h2-6,15-16,18H,1,7-13H2 |
| InChIKey | PNPIAQQGGDURJL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|