C22H27NO7S — CID 87739430
[1-(1-adamantyl)-1-(3-nitrophenyl)sulfonyloxyethyl] 2-methylprop-2-enoate (PubChem CID 87739430) has the molecular formula C22H27NO7S and a molecular weight of 449.53 g/mol. Its IUPAC name is [1-(1-adamantyl)-1-(3-nitrophenyl)sulfonyloxyethyl] 2-methylprop-2-enoate.
| Compound Name | [1-(1-adamantyl)-1-(3-nitrophenyl)sulfonyloxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87739430 |
| Molecular Formula | C22H27NO7S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [1-(1-adamantyl)-1-(3-nitrophenyl)sulfonyloxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(OS(=O)(=O)c1cccc([N+](=O)[O-])c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H27NO7S/c1-14(2)20(24)29-21(3,22-11-15-7-16(12-22)9-17(8-15)13-22)30-31(27,28)19-6-4-5-18(10-19)23(25)26/h4-6,10,15-17H,1,7-9,11-13H2,2-3H3 |
| InChIKey | FXSZHORZQKLEBH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|