C32H30N2O3 — CID 140524716
2'-[anilino-[methyl(2-methylpropyl)amino]methyl]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 140524716) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2'-[anilino-[methyl(2-methylpropyl)amino]methyl]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-[anilino-[methyl(2-methylpropyl)amino]methyl]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 140524716 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 2'-[anilino-[methyl(2-methylpropyl)amino]methyl]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC(C)CN(C)C(Nc1ccccc1)c1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccccc1O2 |
| InChI | InChI=1S/C32H30N2O3/c1-21(2)20-34(3)30(33-23-11-5-4-6-12-23)22-17-18-29-27(19-22)32(26-15-9-10-16-28(26)36-29)25-14-8-7-13-24(25)31(35)37-32/h4-19,21,30,33H,20H2,1-3H3 |
| InChIKey | NDWHCPNAWFIORU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|