C16H12F3NO2 — CID 140524901
2,2,2-trifluoroethyl 4H-benzo[a]quinolizine-3-carboxylate (PubChem CID 140524901) has the molecular formula C16H12F3NO2 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4H-benzo[a]quinolizine-3-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 4H-benzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 140524901 |
| Molecular Formula | C16H12F3NO2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 4H-benzo[a]quinolizine-3-carboxylate |
| SMILES | O=C(OCC(F)(F)F)C1=CC=C2c3ccccc3C=CN2C1 |
| InChI | InChI=1S/C16H12F3NO2/c17-16(18,19)10-22-15(21)12-5-6-14-13-4-2-1-3-11(13)7-8-20(14)9-12/h1-8H,9-10H2 |
| InChIKey | WWPRTXGRBMPTMP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |