C22H15CuF3NO2 — CID 134845931
copper(1+);methyl 4,4,4-trifluoro-3-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enoate (PubChem CID 134845931) has the molecular formula C22H15CuF3NO2 and a molecular weight of 445.91 g/mol. Its IUPAC name is copper(1+);methyl 4,4,4-trifluoro-3-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enoate.
| Compound Name | copper(1+);methyl 4,4,4-trifluoro-3-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 134845931 |
| Molecular Formula | C22H15CuF3NO2 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | copper(1+);methyl 4,4,4-trifluoro-3-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enoate |
| SMILES | COC(=O)/[C-]=C(/N1C=Cc2ccccc2C1C#Cc1ccccc1)C(F)(F)F.[Cu+] |
| InChI | InChI=1S/C22H15F3NO2.Cu/c1-28-21(27)15-20(22(23,24)25)26-14-13-17-9-5-6-10-18(17)19(26)12-11-16-7-3-2-4-8-16;/h2-10,13-14,19H,1H3;/q-1;+1 |
| InChIKey | VGFNRJSWUCHMCW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|