C25H23NO4 — CID 102389538
diethyl (E)-2-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enedioate (PubChem CID 102389538) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is diethyl (E)-2-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enedioate.
| Compound Name | diethyl (E)-2-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 102389538 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | diethyl (E)-2-[1-(2-phenylethynyl)-1H-isoquinolin-2-yl]but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C(=O)OCC)N1C=Cc2ccccc2C1C#Cc1ccccc1 |
| InChI | InChI=1S/C25H23NO4/c1-3-29-24(27)18-23(25(28)30-4-2)26-17-16-20-12-8-9-13-21(20)22(26)15-14-19-10-6-5-7-11-19/h5-13,16-18,22H,3-4H2,1-2H3/b23-18+ |
| InChIKey | WMLMWJGVRHTPMP-PTGBLXJZSA-N |
| XLogP | 4.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|