C27H27NO4 — CID 25058489
dimethyl (E)-2-[1-[2-(4-tert-butylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate (PubChem CID 25058489) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is dimethyl (E)-2-[1-[2-(4-tert-butylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[1-[2-(4-tert-butylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 25058489 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | dimethyl (E)-2-[1-[2-(4-tert-butylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)N1C=Cc2ccccc2C1C#Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-27(2,3)21-13-10-19(11-14-21)12-15-23-22-9-7-6-8-20(22)16-17-28(23)24(26(30)32-5)18-25(29)31-4/h6-11,13-14,16-18,23H,1-5H3/b24-18+ |
| InChIKey | LTNLUWICFVIWGF-HKOYGPOVSA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|