C18H19NO5 — CID 76845103
dimethyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate (PubChem CID 76845103) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is dimethyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 76845103 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | dimethyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)N1C=Cc2ccccc2C1CC(C)=O |
| InChI | InChI=1S/C18H19NO5/c1-12(20)10-15-14-7-5-4-6-13(14)8-9-19(15)16(18(22)24-3)11-17(21)23-2/h4-9,11,15H,10H2,1-3H3/b16-11+ |
| InChIKey | BFDFSRLLDORBMZ-LFIBNONCSA-N |
| XLogP | 2.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|