C21H22FNO2 — CID 144754894
methyl (Z)-2-[ethenyl-[[2-(4-fluorophenyl)phenyl]methyl]amino]pent-2-enoate (PubChem CID 144754894) has the molecular formula C21H22FNO2 and a molecular weight of 339.41 g/mol. Its IUPAC name is methyl (Z)-2-[ethenyl-[[2-(4-fluorophenyl)phenyl]methyl]amino]pent-2-enoate.
| Compound Name | methyl (Z)-2-[ethenyl-[[2-(4-fluorophenyl)phenyl]methyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 144754894 |
| Molecular Formula | C21H22FNO2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl (Z)-2-[ethenyl-[[2-(4-fluorophenyl)phenyl]methyl]amino]pent-2-enoate |
| SMILES | C=CN(Cc1ccccc1-c1ccc(F)cc1)/C(=C\CC)C(=O)OC |
| InChI | InChI=1S/C21H22FNO2/c1-4-8-20(21(24)25-3)23(5-2)15-17-9-6-7-10-19(17)16-11-13-18(22)14-12-16/h5-14H,2,4,15H2,1,3H3/b20-8- |
| InChIKey | KTNDBCYUFIVNPJ-ZBKNUEDVSA-N |
| XLogP | 4.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|