C23H25NO6 — CID 139221401
dimethyl (Z)-2-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-1H-isoquinolin-2-yl]but-2-enedioate (PubChem CID 139221401) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is dimethyl (Z)-2-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-1H-isoquinolin-2-yl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-1H-isoquinolin-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 139221401 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | dimethyl (Z)-2-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)-1H-isoquinolin-2-yl]but-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)N1C=Cc2ccccc2C1C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C23H25NO6/c1-23(2)12-17(25)20(18(26)13-23)21-15-8-6-5-7-14(15)9-10-24(21)16(22(28)30-4)11-19(27)29-3/h5-11,20-21H,12-13H2,1-4H3/b16-11- |
| InChIKey | GUZSNYCFZLOWDD-WJDWOHSUSA-N |
| XLogP | 2.82 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|