C24H31NO5 — CID 135005021
ditert-butyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate (PubChem CID 135005021) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is ditert-butyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate.
| Compound Name | ditert-butyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 135005021 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | ditert-butyl (E)-2-[1-(2-oxopropyl)-1H-isoquinolin-2-yl]but-2-enedioate |
| SMILES | CC(=O)CC1c2ccccc2C=CN1/C(=C/C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31NO5/c1-16(26)14-19-18-11-9-8-10-17(18)12-13-25(19)20(22(28)30-24(5,6)7)15-21(27)29-23(2,3)4/h8-13,15,19H,14H2,1-7H3/b20-15+ |
| InChIKey | ATCUBMLPAAYDMA-HMMYKYKNSA-N |
| XLogP | 4.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|