C18H21NO5 — CID 138377169
dimethyl (Z)-2-[methyl-[(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)methyl]amino]but-2-enedioate (PubChem CID 138377169) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is dimethyl (Z)-2-[methyl-[(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)methyl]amino]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[methyl-[(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)methyl]amino]but-2-enedioate |
|---|---|
| PubChem CID | 138377169 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | dimethyl (Z)-2-[methyl-[(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)methyl]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/C(=O)OC)N(C)CC1CCc2ccccc2C1=O |
| InChI | InChI=1S/C18H21NO5/c1-19(15(18(22)24-3)10-16(20)23-2)11-13-9-8-12-6-4-5-7-14(12)17(13)21/h4-7,10,13H,8-9,11H2,1-3H3/b15-10- |
| InChIKey | SCTPBLVRZCTZTO-GDNBJRDFSA-N |
| XLogP | 1.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|