C26H25NO4 — CID 102389539
diethyl (E)-2-[1-[2-(4-methylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate (PubChem CID 102389539) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is diethyl (E)-2-[1-[2-(4-methylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate.
| Compound Name | diethyl (E)-2-[1-[2-(4-methylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate |
|---|---|
| PubChem CID | 102389539 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | diethyl (E)-2-[1-[2-(4-methylphenyl)ethynyl]-1H-isoquinolin-2-yl]but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\C(=O)OCC)N1C=Cc2ccccc2C1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C26H25NO4/c1-4-30-25(28)18-24(26(29)31-5-2)27-17-16-21-8-6-7-9-22(21)23(27)15-14-20-12-10-19(3)11-13-20/h6-13,16-18,23H,4-5H2,1-3H3/b24-18+ |
| InChIKey | CLNLNVCDAQHHGN-HKOYGPOVSA-N |
| XLogP | 4.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|