C22H22Cl2N4OS — CID 140526366
N-[5-(2-phenylmethoxyethyl)-2-pyridinyl]-6-(1,3-thiazol-2-yl)pyridin-2-amine;dihydrochloride (PubChem CID 140526366) has the molecular formula C22H22Cl2N4OS and a molecular weight of 461.42 g/mol. Its IUPAC name is N-[5-(2-phenylmethoxyethyl)-2-pyridinyl]-6-(1,3-thiazol-2-yl)pyridin-2-amine;dihydrochloride.
| Compound Name | N-[5-(2-phenylmethoxyethyl)-2-pyridinyl]-6-(1,3-thiazol-2-yl)pyridin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 140526366 |
| Molecular Formula | C22H22Cl2N4OS |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[5-(2-phenylmethoxyethyl)-2-pyridinyl]-6-(1,3-thiazol-2-yl)pyridin-2-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(COCCc2ccc(Nc3cccc(-c4nccs4)n3)nc2)cc1 |
| InChI | InChI=1S/C22H20N4OS.2ClH/c1-2-5-18(6-3-1)16-27-13-11-17-9-10-20(24-15-17)26-21-8-4-7-19(25-21)22-23-12-14-28-22;;/h1-10,12,14-15H,11,13,16H2,(H,24,25,26);2*1H |
| InChIKey | NTGGVEWIJRIANJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|