C23H40O3 — CID 140526679
3,5-bis(1-cyclohexylethyl)-2-hydroxycyclohexane-1-carboxylic acid (PubChem CID 140526679) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is 3,5-bis(1-cyclohexylethyl)-2-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 3,5-bis(1-cyclohexylethyl)-2-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 140526679 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 3,5-bis(1-cyclohexylethyl)-2-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CC(C1CCCCC1)C1CC(C(=O)O)C(O)C(C(C)C2CCCCC2)C1 |
| InChI | InChI=1S/C23H40O3/c1-15(17-9-5-3-6-10-17)19-13-20(22(24)21(14-19)23(25)26)16(2)18-11-7-4-8-12-18/h15-22,24H,3-14H2,1-2H3,(H,25,26) |
| InChIKey | QLSQHWAITKSZSB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |