C11H18O5 — CID 168747858
4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid (PubChem CID 168747858) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid.
| Compound Name | 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 168747858 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid |
| SMILES | CC(C)C1CC(C(=O)O)CC(C(=O)O)C1O |
| InChI | InChI=1S/C11H18O5/c1-5(2)7-3-6(10(13)14)4-8(9(7)12)11(15)16/h5-9,12H,3-4H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | GMUCYTWIFIZSIA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |