4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid

C11H18O5 — CID 168747858

IUPAC4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid
SMILESCC(C)C1CC(C(=O)O)CC(C(=O)O)C1O
InChIInChI=1S/C11H18O5/c1-5(2)7-3-6(10(13)14)4-8(9(7)12)11(15)16/h5-9,12H,3-4H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyGMUCYTWIFIZSIA-UHFFFAOYSA-N
MW230.26 g/mol
LogP0.81
Rot. Bonds3

About 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid

4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid (PubChem CID 168747858) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid
PubChem CID168747858
Molecular FormulaC11H18O5
Molecular Weight230.26 g/mol
Exact Mass230.12
IUPAC Name4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid
SMILESCC(C)C1CC(C(=O)O)CC(C(=O)O)C1O
InChIInChI=1S/C11H18O5/c1-5(2)7-3-6(10(13)14)4-8(9(7)12)11(15)16/h5-9,12H,3-4H2,1-2H3,(H,13,14)(H,15,16)
InChIKeyGMUCYTWIFIZSIA-UHFFFAOYSA-N
XLogP0.81
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.26
LogP ≤ 50.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
The IUPAC name of 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid (CID 168747858) is 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid.
What is the SMILES notation for 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
The canonical SMILES for 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid is CC(C)C1CC(C(=O)O)CC(C(=O)O)C1O.
What is the InChIKey of 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
The InChIKey is GMUCYTWIFIZSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5/c1-5(2)7-3-6(10(13)14)4-8(9(7)12)11(15)16/h5-9,12H,3-4H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid has a molecular weight of 230.26 g/mol, XLogP of 0.81, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-propan-2-ylcyclohexane-1,3-dicarboxylic acid is sourced from PubChem (CID 168747858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).