C60H99AlO15 — CID 140527183
bis[[2,2-di(hexanoyl)-3-oxooctanoyl]oxy]alumanyl 2,2-di(hexanoyl)-3-oxooctanoate (PubChem CID 140527183) has the molecular formula C60H99AlO15 and a molecular weight of 1087.42 g/mol. Its IUPAC name is bis[[2,2-di(hexanoyl)-3-oxooctanoyl]oxy]alumanyl 2,2-di(hexanoyl)-3-oxooctanoate.
| Compound Name | bis[[2,2-di(hexanoyl)-3-oxooctanoyl]oxy]alumanyl 2,2-di(hexanoyl)-3-oxooctanoate |
|---|---|
| PubChem CID | 140527183 |
| Molecular Formula | C60H99AlO15 |
| Molecular Weight | 1087.42 g/mol |
| Exact Mass | 1086.68 |
| IUPAC Name | bis[[2,2-di(hexanoyl)-3-oxooctanoyl]oxy]alumanyl 2,2-di(hexanoyl)-3-oxooctanoate |
| SMILES | CCCCCC(=O)C(C(=O)CCCCC)(C(=O)CCCCC)C(=O)O[Al](OC(=O)C(C(=O)CCCCC)(C(=O)CCCCC)C(=O)CCCCC)OC(=O)C(C(=O)CCCCC)(C(=O)CCCCC)C(=O)CCCCC |
| InChI | InChI=1S/3C20H34O5.Al/c3*1-4-7-10-13-16(21)20(19(24)25,17(22)14-11-8-5-2)18(23)15-12-9-6-3;/h3*4-15H2,1-3H3,(H,24,25);/q;;;+3/p-3 |
| InChIKey | YRYFUDZAEXOOKK-UHFFFAOYSA-K |
| XLogP | 12.90 |
| TPSA | 232.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.42 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|