About heptyl-iodo-tripropyl-λ5-phosphane
heptyl-iodo-tripropyl-λ5-phosphane (PubChem CID 140527815) has the molecular formula C16H36IP
and a molecular weight of 386.34 g/mol. Its IUPAC name is heptyl-iodo-tripropyl-λ5-phosphane.
Molecular Properties
| Compound Name | heptyl-iodo-tripropyl-λ5-phosphane |
| PubChem CID | 140527815 |
| Molecular Formula | C16H36IP |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | heptyl-iodo-tripropyl-λ5-phosphane |
| SMILES | CCCCCCCP(I)(CCC)(CCC)CCC |
| InChI | InChI=1S/C16H36IP/c1-5-9-10-11-12-16-18(17,13-6-2,14-7-3)15-8-4/h5-16H2,1-4H3 |
| InChIKey | SUCQMGHQUCNYSW-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze heptyl-iodo-tripropyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl-iodo-tripropyl-λ5-phosphane?
The IUPAC name of heptyl-iodo-tripropyl-λ5-phosphane (CID 140527815) is heptyl-iodo-tripropyl-λ5-phosphane.
What is the SMILES notation for heptyl-iodo-tripropyl-λ5-phosphane?
The canonical SMILES for heptyl-iodo-tripropyl-λ5-phosphane is CCCCCCCP(I)(CCC)(CCC)CCC.
What is the InChIKey of heptyl-iodo-tripropyl-λ5-phosphane?
The InChIKey is SUCQMGHQUCNYSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36IP/c1-5-9-10-11-12-16-18(17,13-6-2,14-7-3)15-8-4/h5-16H2,1-4H3.
What are the key properties of heptyl-iodo-tripropyl-λ5-phosphane?
heptyl-iodo-tripropyl-λ5-phosphane has a molecular weight of 386.34 g/mol, XLogP of 7.09, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl-iodo-tripropyl-λ5-phosphane is sourced from PubChem (CID 140527815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).