About triheptyl-iodo-methyl-λ5-phosphane
triheptyl-iodo-methyl-λ5-phosphane (PubChem CID 140527858) has the molecular formula C22H48IP
and a molecular weight of 470.50 g/mol. Its IUPAC name is triheptyl-iodo-methyl-λ5-phosphane.
Molecular Properties
| Compound Name | triheptyl-iodo-methyl-λ5-phosphane |
| PubChem CID | 140527858 |
| Molecular Formula | C22H48IP |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | triheptyl-iodo-methyl-λ5-phosphane |
| SMILES | CCCCCCCP(C)(I)(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C22H48IP/c1-5-8-11-14-17-20-24(4,23,21-18-15-12-9-6-2)22-19-16-13-10-7-3/h5-22H2,1-4H3 |
| InChIKey | UHDAQYINPOYYNZ-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triheptyl-iodo-methyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triheptyl-iodo-methyl-λ5-phosphane?
The IUPAC name of triheptyl-iodo-methyl-λ5-phosphane (CID 140527858) is triheptyl-iodo-methyl-λ5-phosphane.
What is the SMILES notation for triheptyl-iodo-methyl-λ5-phosphane?
The canonical SMILES for triheptyl-iodo-methyl-λ5-phosphane is CCCCCCCP(C)(I)(CCCCCCC)CCCCCCC.
What is the InChIKey of triheptyl-iodo-methyl-λ5-phosphane?
The InChIKey is UHDAQYINPOYYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48IP/c1-5-8-11-14-17-20-24(4,23,21-18-15-12-9-6-2)22-19-16-13-10-7-3/h5-22H2,1-4H3.
What are the key properties of triheptyl-iodo-methyl-λ5-phosphane?
triheptyl-iodo-methyl-λ5-phosphane has a molecular weight of 470.50 g/mol, XLogP of 9.43, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triheptyl-iodo-methyl-λ5-phosphane is sourced from PubChem (CID 140527858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).