About iodo-trioctyl-propyl-λ5-phosphane
iodo-trioctyl-propyl-λ5-phosphane (PubChem CID 140528088) has the molecular formula C27H58IP
and a molecular weight of 540.64 g/mol. Its IUPAC name is iodo-trioctyl-propyl-λ5-phosphane.
Molecular Properties
| Compound Name | iodo-trioctyl-propyl-λ5-phosphane |
| PubChem CID | 140528088 |
| Molecular Formula | C27H58IP |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | iodo-trioctyl-propyl-λ5-phosphane |
| SMILES | CCCCCCCCP(I)(CCC)(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C27H58IP/c1-5-9-12-15-18-21-25-29(28,24-8-4,26-22-19-16-13-10-6-2)27-23-20-17-14-11-7-3/h5-27H2,1-4H3 |
| InChIKey | WWTYADSZRXDQTF-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodo-trioctyl-propyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo-trioctyl-propyl-λ5-phosphane?
The IUPAC name of iodo-trioctyl-propyl-λ5-phosphane (CID 140528088) is iodo-trioctyl-propyl-λ5-phosphane.
What is the SMILES notation for iodo-trioctyl-propyl-λ5-phosphane?
The canonical SMILES for iodo-trioctyl-propyl-λ5-phosphane is CCCCCCCCP(I)(CCC)(CCCCCCCC)CCCCCCCC.
What is the InChIKey of iodo-trioctyl-propyl-λ5-phosphane?
The InChIKey is WWTYADSZRXDQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H58IP/c1-5-9-12-15-18-21-25-29(28,24-8-4,26-22-19-16-13-10-6-2)27-23-20-17-14-11-7-3/h5-27H2,1-4H3.
What are the key properties of iodo-trioctyl-propyl-λ5-phosphane?
iodo-trioctyl-propyl-λ5-phosphane has a molecular weight of 540.64 g/mol, XLogP of 11.38, 23 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iodo-trioctyl-propyl-λ5-phosphane is sourced from PubChem (CID 140528088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).