C6H5NS3 — CID 140529160
5-amino-7,8-dithiabicyclo[4.2.0]octa-1,3,5-triene-2-thiol (PubChem CID 140529160) has the molecular formula C6H5NS3 and a molecular weight of 187.31 g/mol. Its IUPAC name is 5-amino-7,8-dithiabicyclo[4.2.0]octa-1,3,5-triene-2-thiol.
| Compound Name | 5-amino-7,8-dithiabicyclo[4.2.0]octa-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 140529160 |
| Molecular Formula | C6H5NS3 |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 186.96 |
| IUPAC Name | 5-amino-7,8-dithiabicyclo[4.2.0]octa-1,3,5-triene-2-thiol |
| SMILES | Nc1ccc(S)c2ssc12 |
| InChI | InChI=1S/C6H5NS3/c7-3-1-2-4(8)6-5(3)9-10-6/h1-2,8H,7H2 |
| InChIKey | VYRAGLLKFZTXCX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|