C25H22N2O5 — CID 140529940
ethyl 3-[[3-(4-hydroxyphenyl)-4-oxoquinazolin-7-yl]oxymethyl]-2-methylbenzoate (PubChem CID 140529940) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is ethyl 3-[[3-(4-hydroxyphenyl)-4-oxoquinazolin-7-yl]oxymethyl]-2-methylbenzoate.
| Compound Name | ethyl 3-[[3-(4-hydroxyphenyl)-4-oxoquinazolin-7-yl]oxymethyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 140529940 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | ethyl 3-[[3-(4-hydroxyphenyl)-4-oxoquinazolin-7-yl]oxymethyl]-2-methylbenzoate |
| SMILES | CCOC(=O)c1cccc(COc2ccc3c(=O)n(-c4ccc(O)cc4)cnc3c2)c1C |
| InChI | InChI=1S/C25H22N2O5/c1-3-31-25(30)21-6-4-5-17(16(21)2)14-32-20-11-12-22-23(13-20)26-15-27(24(22)29)18-7-9-19(28)10-8-18/h4-13,15,28H,3,14H2,1-2H3 |
| InChIKey | OTAXFXZWAJGWMS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |