C21H26N2O4 — CID 140532876
(1-hydroxy-3-morpholin-4-yl-1-phenylpropan-2-yl) N-benzylcarbamate (PubChem CID 140532876) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1-hydroxy-3-morpholin-4-yl-1-phenylpropan-2-yl) N-benzylcarbamate.
| Compound Name | (1-hydroxy-3-morpholin-4-yl-1-phenylpropan-2-yl) N-benzylcarbamate |
|---|---|
| PubChem CID | 140532876 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (1-hydroxy-3-morpholin-4-yl-1-phenylpropan-2-yl) N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OC(CN1CCOCC1)C(O)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O4/c24-20(18-9-5-2-6-10-18)19(16-23-11-13-26-14-12-23)27-21(25)22-15-17-7-3-1-4-8-17/h1-10,19-20,24H,11-16H2,(H,22,25) |
| InChIKey | OGWCUVSHJWQVCC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |