About 2-hexoxy-3-nonyloxirene
2-hexoxy-3-nonyloxirene (PubChem CID 140533265) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is 2-hexoxy-3-nonyloxirene.
Molecular Properties
| Compound Name | 2-hexoxy-3-nonyloxirene |
| PubChem CID | 140533265 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 2-hexoxy-3-nonyloxirene |
| SMILES | CCCCCCCCCC1=C(OCCCCCC)O1 |
| InChI | InChI=1S/C17H32O2/c1-3-5-7-9-10-11-12-14-16-17(19-16)18-15-13-8-6-4-2/h3-15H2,1-2H3 |
| InChIKey | RYAYUXIZINNUBR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexoxy-3-nonyloxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexoxy-3-nonyloxirene?
The IUPAC name of 2-hexoxy-3-nonyloxirene (CID 140533265) is 2-hexoxy-3-nonyloxirene.
What is the SMILES notation for 2-hexoxy-3-nonyloxirene?
The canonical SMILES for 2-hexoxy-3-nonyloxirene is CCCCCCCCCC1=C(OCCCCCC)O1.
What is the InChIKey of 2-hexoxy-3-nonyloxirene?
The InChIKey is RYAYUXIZINNUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O2/c1-3-5-7-9-10-11-12-14-16-17(19-16)18-15-13-8-6-4-2/h3-15H2,1-2H3.
What are the key properties of 2-hexoxy-3-nonyloxirene?
2-hexoxy-3-nonyloxirene has a molecular weight of 268.44 g/mol, XLogP of 5.92, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexoxy-3-nonyloxirene is sourced from PubChem (CID 140533265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).