C11H7FN2O — CID 140533295
6-fluoro-2,3-dihydropyrrolo[3,4-b]quinolin-1-one (PubChem CID 140533295) has the molecular formula C11H7FN2O and a molecular weight of 202.19 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydropyrrolo[3,4-b]quinolin-1-one.
| Compound Name | 6-fluoro-2,3-dihydropyrrolo[3,4-b]quinolin-1-one |
|---|---|
| PubChem CID | 140533295 |
| Molecular Formula | C11H7FN2O |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 6-fluoro-2,3-dihydropyrrolo[3,4-b]quinolin-1-one |
| SMILES | O=C1NCc2nc3cc(F)ccc3cc21 |
| InChI | InChI=1S/C11H7FN2O/c12-7-2-1-6-3-8-10(5-13-11(8)15)14-9(6)4-7/h1-4H,5H2,(H,13,15) |
| InChIKey | ZUMYLYUQSFTLFG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |