C22H21F3N4O4S — CID 14053377
1,3-dimethyl-4,6-dioxo-N-[2-propan-2-yl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-sulfanylidene-1,3-diazinane-5-carboxamide (PubChem CID 14053377) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is 1,3-dimethyl-4,6-dioxo-N-[2-propan-2-yl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-sulfanylidene-1,3-diazinane-5-carboxamide.
| Compound Name | 1,3-dimethyl-4,6-dioxo-N-[2-propan-2-yl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-sulfanylidene-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 14053377 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1,3-dimethyl-4,6-dioxo-N-[2-propan-2-yl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]-2-sulfanylidene-1,3-diazinane-5-carboxamide |
| SMILES | CC(C)c1cc(Oc2ccc(C(F)(F)F)cn2)ccc1NC(=O)C1C(=O)N(C)C(=S)N(C)C1=O |
| InChI | InChI=1S/C22H21F3N4O4S/c1-11(2)14-9-13(33-16-8-5-12(10-26-16)22(23,24)25)6-7-15(14)27-18(30)17-19(31)28(3)21(34)29(4)20(17)32/h5-11,17H,1-4H3,(H,27,30) |
| InChIKey | NHQMBSNVHQOGMG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|