C44H42N4O2 — CID 140534106
1-cyclohexyl-6-phenyl-2-(2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl)-4-(1,2,3,4-tetrahydroquinolin-6-yl)benzimidazole-5-carboxylic acid (PubChem CID 140534106) has the molecular formula C44H42N4O2 and a molecular weight of 658.85 g/mol. Its IUPAC name is 1-cyclohexyl-6-phenyl-2-(2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl)-4-(1,2,3,4-tetrahydroquinolin-6-yl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-6-phenyl-2-(2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl)-4-(1,2,3,4-tetrahydroquinolin-6-yl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 140534106 |
| Molecular Formula | C44H42N4O2 |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | 1-cyclohexyl-6-phenyl-2-(2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl)-4-(1,2,3,4-tetrahydroquinolin-6-yl)benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2)cc2c(nc(-c3ccc4c(c3)CCC(c3ccccc3)N4)n2C2CCCCC2)c1-c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C44H42N4O2/c49-44(50)41-35(28-11-4-1-5-12-28)27-39-42(40(41)32-19-21-36-30(25-32)15-10-24-45-36)47-43(48(39)34-16-8-3-9-17-34)33-20-23-38-31(26-33)18-22-37(46-38)29-13-6-2-7-14-29/h1-2,4-7,11-14,19-21,23,25-27,34,37,45-46H,3,8-10,15-18,22,24H2,(H,49,50) |
| InChIKey | QJCKBJUBSIXUIP-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |