C20H40O7P2 — CID 140535407
dibutyl [cyclohexyl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl] phosphate (PubChem CID 140535407) has the molecular formula C20H40O7P2 and a molecular weight of 454.48 g/mol. Its IUPAC name is dibutyl [cyclohexyl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl] phosphate.
| Compound Name | dibutyl [cyclohexyl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl] phosphate |
|---|---|
| PubChem CID | 140535407 |
| Molecular Formula | C20H40O7P2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | dibutyl [cyclohexyl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl] phosphate |
| SMILES | CCCCOP(=O)(OCCCC)OC(C1CCCCC1)P1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C20H40O7P2/c1-5-7-14-23-29(22,24-15-8-6-2)27-19(18-12-10-9-11-13-18)28(21)25-16-20(3,4)17-26-28/h18-19H,5-17H2,1-4H3 |
| InChIKey | SCBYQSNMGONAMQ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|