C17H32O7P2 — CID 140535406
2-[cyclohexyl-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 140535406) has the molecular formula C17H32O7P2 and a molecular weight of 410.38 g/mol. Its IUPAC name is 2-[cyclohexyl-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-[cyclohexyl-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 140535406 |
| Molecular Formula | C17H32O7P2 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[cyclohexyl-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]methyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)(OC(C2CCCCC2)P2(=O)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C17H32O7P2/c1-16(2)10-20-25(18,21-11-16)15(14-8-6-5-7-9-14)24-26(19)22-12-17(3,4)13-23-26/h14-15H,5-13H2,1-4H3 |
| InChIKey | IIIORFNBJBLORB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|